Name: | N-Methyl-2-pyrrolidone | Other Name: | N-Methylpyrrolidone; 1-Methyl-2-pyrrolidinone, anhydrous; NMP; N-Methyl pyrrolidone; N-Methyl-2-pyrrolidone; N-Methyl-2-pyrrolidinone; N-Methyl-pyrrolidone; NMP-EL; NMP-T; N-METHYLPYRROLIDNONE; N-METHYLPYRROLIDINONE; N-METHYLPYRROLID-2-ONE; N-METHYLPYROLIDONE; M-PYROL(R); 1-Methyl-2-pyrrolidone | CAS NO: | 872-50-4;2687-44-7 | EINECS NO: | 212-828-1 | Molecular Formula: | C5H9NO | Molecular Weight: | 99.13 | InChI: | InChI=1/C5H9NO/c1-6-4-2-3-5(6)7/h2-4H2,1H3 | Density: | 1.033 | Melting Point: | -24℃ | Boiling Point: | 202℃ | Flash Point: | 91℃ | Water Solubility: | >=10 g/100 mL at 20℃ | Appearance | Slight amine odor clear colorless liquid | Purity | ≥99.5% | Vapour Density | 3.4(vsair) | Vapour Pressure | 0.29mmHg(20°C) | Refractive Rate | n20/D1.479 | Storage Condition | 2-8°C | Solubility | miscible 0.1ML/mL,clear,colorless(10%,v/v) | Acid Value | (pKa)-0.41±0.20 | PH Value | 8.5-10.0(100g/l,H2O,20℃) | Explosive limit | 1.3-9.5%(V) | Sensitivity | Hygroscopic | Stability | Stable,but decomposes upon exposure to light.Combustible.Incompatible with strong oxidizing agents,strong acids,reducing agents,bases. | Moisture Content | ≤0.1% |
|
